C12H8N8O9 — CID 173335308
2,4,8,10-tetranitro-6,12-dihydrobenzotriazolo[2,1-a]benzotriazole;hydrate (PubChem CID 173335308) has the molecular formula C12H8N8O9 and a molecular weight of 408.24 g/mol. Its IUPAC name is 2,4,8,10-tetranitro-6,12-dihydrobenzotriazolo[2,1-a]benzotriazole;hydrate.
| Compound Name | 2,4,8,10-tetranitro-6,12-dihydrobenzotriazolo[2,1-a]benzotriazole;hydrate |
|---|---|
| PubChem CID | 173335308 |
| Molecular Formula | C12H8N8O9 |
| Molecular Weight | 408.24 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | 2,4,8,10-tetranitro-6,12-dihydrobenzotriazolo[2,1-a]benzotriazole;hydrate |
| SMILES | O.O=[N+]([O-])c1cc2c(c([N+](=O)[O-])c1)N1Nc3cc([N+](=O)[O-])cc([N+](=O)[O-])c3N1N2 |
| InChI | InChI=1S/C12H6N8O8.H2O/c21-17(22)5-1-7-11(9(3-5)19(25)26)15-14-8-2-6(18(23)24)4-10(20(27)28)12(8)16(15)13-7;/h1-4,13-14H;1H2 |
| InChIKey | JJOIPHBPLGMPKQ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 234.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|