C12H15N3O4 — CID 3319667
1,2,3,3-tetramethyl-4,6-dinitro-2H-indole (PubChem CID 3319667) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is 1,2,3,3-tetramethyl-4,6-dinitro-2H-indole.
| Compound Name | 1,2,3,3-tetramethyl-4,6-dinitro-2H-indole |
|---|---|
| PubChem CID | 3319667 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 1,2,3,3-tetramethyl-4,6-dinitro-2H-indole |
| SMILES | CC1N(C)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2C1(C)C |
| InChI | InChI=1S/C12H15N3O4/c1-7-12(2,3)11-9(13(7)4)5-8(14(16)17)6-10(11)15(18)19/h5-7H,1-4H3 |
| InChIKey | IAXLZRAKLPJWKH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|