C31H25N6O4+ — CID 101385784
6,8,17,19-tetramethyl-10,21-diphenyl-6,8,17,19,21-pentaza-10-azoniapentacyclo[12.7.0.03,11.04,9.015,20]henicosa-1(14),2,4(9),10,12,15(20)-hexaene-5,7,16,18-tetrone (PubChem CID 101385784) has the molecular formula C31H25N6O4+ and a molecular weight of 545.58 g/mol. Its IUPAC name is 6,8,17,19-tetramethyl-10,21-diphenyl-6,8,17,19,21-pentaza-10-azoniapentacyclo[12.7.0.03,11.04,9.015,20]henicosa-1(14),2,4(9),10,12,15(20)-hexaene-5,7,16,18-tetrone.
| Compound Name | 6,8,17,19-tetramethyl-10,21-diphenyl-6,8,17,19,21-pentaza-10-azoniapentacyclo[12.7.0.03,11.04,9.015,20]henicosa-1(14),2,4(9),10,12,15(20)-hexaene-5,7,16,18-tetrone |
|---|---|
| PubChem CID | 101385784 |
| Molecular Formula | C31H25N6O4+ |
| Molecular Weight | 545.58 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | 6,8,17,19-tetramethyl-10,21-diphenyl-6,8,17,19,21-pentaza-10-azoniapentacyclo[12.7.0.03,11.04,9.015,20]henicosa-1(14),2,4(9),10,12,15(20)-hexaene-5,7,16,18-tetrone |
| SMILES | Cn1c(=O)c2c3ccc4[n+](-c5ccccc5)c5c(c-4cc3n(-c3ccccc3)c2n(C)c1=O)c(=O)n(C)c(=O)n5C |
| InChI | InChI=1S/C31H25N6O4/c1-32-26-24(28(38)34(3)30(32)40)20-15-16-22-21(17-23(20)37(26)19-13-9-6-10-14-19)25-27(33(2)31(41)35(4)29(25)39)36(22)18-11-7-5-8-12-18/h5-17H,1-4H3/q+1 |
| InChIKey | LIJRRZCWWGLPOU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 96.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.58 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|