C15H9IN2 — CID 101386213
2-iodo-10H-indolo[3,2-b]quinoline (PubChem CID 101386213) has the molecular formula C15H9IN2 and a molecular weight of 344.16 g/mol. Its IUPAC name is 2-iodo-10H-indolo[3,2-b]quinoline.
| Compound Name | 2-iodo-10H-indolo[3,2-b]quinoline |
|---|---|
| PubChem CID | 101386213 |
| Molecular Formula | C15H9IN2 |
| Molecular Weight | 344.16 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | 2-iodo-10H-indolo[3,2-b]quinoline |
| SMILES | Ic1ccc2nc3c(cc2c1)[nH]c1ccccc13 |
| InChI | InChI=1S/C15H9IN2/c16-10-5-6-12-9(7-10)8-14-15(18-12)11-3-1-2-4-13(11)17-14/h1-8,17H |
| InChIKey | GFPJAKCEFDRJHO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.16 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|