C25H29F3O6Si — CID 101389026
[(3S,3aR,6R,6aR)-3-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] (2S)-3,3,3-trifluoro-2-phenyl-2-trimethylsilyloxypropanoate (PubChem CID 101389026) has the molecular formula C25H29F3O6Si and a molecular weight of 510.58 g/mol. Its IUPAC name is [(3S,3aR,6R,6aR)-3-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] (2S)-3,3,3-trifluoro-2-phenyl-2-trimethylsilyloxypropanoate.
| Compound Name | [(3S,3aR,6R,6aR)-3-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] (2S)-3,3,3-trifluoro-2-phenyl-2-trimethylsilyloxypropanoate |
|---|---|
| PubChem CID | 101389026 |
| Molecular Formula | C25H29F3O6Si |
| Molecular Weight | 510.58 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | [(3S,3aR,6R,6aR)-3-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] (2S)-3,3,3-trifluoro-2-phenyl-2-trimethylsilyloxypropanoate |
| SMILES | C[Si](C)(C)O[C@](C(=O)O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2OCc1ccccc1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C25H29F3O6Si/c1-35(2,3)34-24(25(26,27)28,18-12-8-5-9-13-18)23(29)33-20-16-32-21-19(15-31-22(20)21)30-14-17-10-6-4-7-11-17/h4-13,19-22H,14-16H2,1-3H3/t19-,20+,21+,22+,24-/m0/s1 |
| InChIKey | LJTMOFKZWQKSNK-PIIZRUITSA-N |
| XLogP | 4.59 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.58 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|