C23H38S5 — CID 101398880
4,5-bis[[(3S)-3,7-dimethyloct-6-enyl]sulfanyl]-1,3-dithiole-2-thione (PubChem CID 101398880) has the molecular formula C23H38S5 and a molecular weight of 474.89 g/mol. Its IUPAC name is 4,5-bis[[(3S)-3,7-dimethyloct-6-enyl]sulfanyl]-1,3-dithiole-2-thione.
| Compound Name | 4,5-bis[[(3S)-3,7-dimethyloct-6-enyl]sulfanyl]-1,3-dithiole-2-thione |
|---|---|
| PubChem CID | 101398880 |
| Molecular Formula | C23H38S5 |
| Molecular Weight | 474.89 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 4,5-bis[[(3S)-3,7-dimethyloct-6-enyl]sulfanyl]-1,3-dithiole-2-thione |
| SMILES | CC(C)=CCC[C@H](C)CCSc1sc(=S)sc1SCC[C@@H](C)CCC=C(C)C |
| InChI | InChI=1S/C23H38S5/c1-17(2)9-7-11-19(5)13-15-25-21-22(28-23(24)27-21)26-16-14-20(6)12-8-10-18(3)4/h9-10,19-20H,7-8,11-16H2,1-6H3/t19-,20-/m0/s1 |
| InChIKey | RVXPQKDLUYXFSK-PMACEKPBSA-N |
| XLogP | 10.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.89 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|