C16H31ClO — CID 101447478
(E,4R,5S)-4-chlorohexadec-6-en-5-ol (PubChem CID 101447478) has the molecular formula C16H31ClO and a molecular weight of 274.88 g/mol. Its IUPAC name is (E,4R,5S)-4-chlorohexadec-6-en-5-ol.
| Compound Name | (E,4R,5S)-4-chlorohexadec-6-en-5-ol |
|---|---|
| PubChem CID | 101447478 |
| Molecular Formula | C16H31ClO |
| Molecular Weight | 274.88 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | (E,4R,5S)-4-chlorohexadec-6-en-5-ol |
| SMILES | CCCCCCCCC/C=C/[C@H](O)[C@H](Cl)CCC |
| InChI | InChI=1S/C16H31ClO/c1-3-5-6-7-8-9-10-11-12-14-16(18)15(17)13-4-2/h12,14-16,18H,3-11,13H2,1-2H3/b14-12+/t15-,16+/m1/s1 |
| InChIKey | PBKGFONQTWXSNJ-VSFMZDRDSA-N |
| XLogP | 5.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.88 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|