C30H29F9O8 — CID 101448314
2,2,2-trifluoroethyl (E,4R,5R)-6,6,6-trifluoro-4-phenylmethoxy-5-[(E,4R,5R)-6,6,6-trifluoro-5-(methoxymethoxy)-4-phenylmethoxyhex-2-enoyl]oxyhex-2-enoate (PubChem CID 101448314) has the molecular formula C30H29F9O8 and a molecular weight of 688.54 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl (E,4R,5R)-6,6,6-trifluoro-4-phenylmethoxy-5-[(E,4R,5R)-6,6,6-trifluoro-5-(methoxymethoxy)-4-phenylmethoxyhex-2-enoyl]oxyhex-2-enoate.
| Compound Name | 2,2,2-trifluoroethyl (E,4R,5R)-6,6,6-trifluoro-4-phenylmethoxy-5-[(E,4R,5R)-6,6,6-trifluoro-5-(methoxymethoxy)-4-phenylmethoxyhex-2-enoyl]oxyhex-2-enoate |
|---|---|
| PubChem CID | 101448314 |
| Molecular Formula | C30H29F9O8 |
| Molecular Weight | 688.54 g/mol |
| Exact Mass | 688.17 |
| IUPAC Name | 2,2,2-trifluoroethyl (E,4R,5R)-6,6,6-trifluoro-4-phenylmethoxy-5-[(E,4R,5R)-6,6,6-trifluoro-5-(methoxymethoxy)-4-phenylmethoxyhex-2-enoyl]oxyhex-2-enoate |
| SMILES | COCO[C@H]([C@@H](/C=C/C(=O)O[C@H]([C@@H](/C=C/C(=O)OCC(F)(F)F)OCc1ccccc1)C(F)(F)F)OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C30H29F9O8/c1-42-19-46-26(29(34,35)36)22(43-16-20-8-4-2-5-9-20)13-15-25(41)47-27(30(37,38)39)23(44-17-21-10-6-3-7-11-21)12-14-24(40)45-18-28(31,32)33/h2-15,22-23,26-27H,16-19H2,1H3/b14-12+,15-13+/t22-,23-,26-,27-/m1/s1 |
| InChIKey | WOQQPWZQUUNJKD-RSDRNULHSA-N |
| XLogP | 6.40 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.54 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|