C33H34O8S2 — CID 101451678
dimethyl (10S,14S)-2,2-bis(benzenesulfonyl)-3,6,7,10,11,14,15,17-octahydro-1H-cyclopenta[a]phenanthrene-16,16-dicarboxylate (PubChem CID 101451678) has the molecular formula C33H34O8S2 and a molecular weight of 622.76 g/mol. Its IUPAC name is dimethyl (10S,14S)-2,2-bis(benzenesulfonyl)-3,6,7,10,11,14,15,17-octahydro-1H-cyclopenta[a]phenanthrene-16,16-dicarboxylate.
| Compound Name | dimethyl (10S,14S)-2,2-bis(benzenesulfonyl)-3,6,7,10,11,14,15,17-octahydro-1H-cyclopenta[a]phenanthrene-16,16-dicarboxylate |
|---|---|
| PubChem CID | 101451678 |
| Molecular Formula | C33H34O8S2 |
| Molecular Weight | 622.76 g/mol |
| Exact Mass | 622.17 |
| IUPAC Name | dimethyl (10S,14S)-2,2-bis(benzenesulfonyl)-3,6,7,10,11,14,15,17-octahydro-1H-cyclopenta[a]phenanthrene-16,16-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2=CCC3=C(CCC4=CCC(S(=O)(=O)c5ccccc5)(S(=O)(=O)c5ccccc5)C[C@@H]43)[C@H]2C1 |
| InChI | InChI=1S/C33H34O8S2/c1-40-30(34)32(31(35)41-2)19-23-14-16-27-26(28(23)20-32)15-13-22-17-18-33(21-29(22)27,42(36,37)24-9-5-3-6-10-24)43(38,39)25-11-7-4-8-12-25/h3-12,14,17,28-29H,13,15-16,18-21H2,1-2H3/t28-,29-/m0/s1 |
| InChIKey | BODWRUQUCRBKIG-VMPREFPWSA-N |
| XLogP | 5.13 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.76 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|