C17H23NO6 — CID 101473210
(2R,3R,6S,7R,8R,9aS)-2,3,8-trihydroxy-6-(hydroxymethyl)-7-phenylmethoxy-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one (PubChem CID 101473210) has the molecular formula C17H23NO6 and a molecular weight of 337.37 g/mol. Its IUPAC name is (2R,3R,6S,7R,8R,9aS)-2,3,8-trihydroxy-6-(hydroxymethyl)-7-phenylmethoxy-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one.
| Compound Name | (2R,3R,6S,7R,8R,9aS)-2,3,8-trihydroxy-6-(hydroxymethyl)-7-phenylmethoxy-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one |
|---|---|
| PubChem CID | 101473210 |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | (2R,3R,6S,7R,8R,9aS)-2,3,8-trihydroxy-6-(hydroxymethyl)-7-phenylmethoxy-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one |
| SMILES | O=C1[C@H](O)[C@H](O)C[C@H]2C[C@@H](O)[C@H](OCc3ccccc3)[C@H](CO)N12 |
| InChI | InChI=1S/C17H23NO6/c19-8-12-16(24-9-10-4-2-1-3-5-10)14(21)7-11-6-13(20)15(22)17(23)18(11)12/h1-5,11-16,19-22H,6-9H2/t11-,12-,13+,14+,15+,16+/m0/s1 |
| InChIKey | RHGHFWOQEANAAQ-KPRKPIBOSA-N |
| XLogP | -0.98 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |