C34H40N4O6 — CID 10153251
N-[2-[furan-2-ylmethyl(2-methylprop-2-enyl)amino]-4,6-dimethoxypyrimidin-5-yl]-5-[(1,1,3,3,6-pentamethyl-2-benzofuran-5-yl)methyl]furan-2-carboxamide (PubChem CID 10153251) has the molecular formula C34H40N4O6 and a molecular weight of 600.72 g/mol. Its IUPAC name is N-[2-[furan-2-ylmethyl(2-methylprop-2-enyl)amino]-4,6-dimethoxypyrimidin-5-yl]-5-[(1,1,3,3,6-pentamethyl-2-benzofuran-5-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[2-[furan-2-ylmethyl(2-methylprop-2-enyl)amino]-4,6-dimethoxypyrimidin-5-yl]-5-[(1,1,3,3,6-pentamethyl-2-benzofuran-5-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 10153251 |
| Molecular Formula | C34H40N4O6 |
| Molecular Weight | 600.72 g/mol |
| Exact Mass | 600.29 |
| IUPAC Name | N-[2-[furan-2-ylmethyl(2-methylprop-2-enyl)amino]-4,6-dimethoxypyrimidin-5-yl]-5-[(1,1,3,3,6-pentamethyl-2-benzofuran-5-yl)methyl]furan-2-carboxamide |
| SMILES | C=C(C)CN(Cc1ccco1)c1nc(OC)c(NC(=O)c2ccc(Cc3cc4c(cc3C)C(C)(C)OC4(C)C)o2)c(OC)n1 |
| InChI | InChI=1S/C34H40N4O6/c1-20(2)18-38(19-24-11-10-14-42-24)32-36-30(40-8)28(31(37-32)41-9)35-29(39)27-13-12-23(43-27)16-22-17-26-25(15-21(22)3)33(4,5)44-34(26,6)7/h10-15,17H,1,16,18-19H2,2-9H3,(H,35,39) |
| InChIKey | XWUQLDKNXGAPBB-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 112.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.72 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|