C25H28ClN3O5 — CID 20745800
N-(2-chloro-4,6-dimethoxypyrimidin-5-yl)-5-[(1,1,3,3,6-pentamethyl-2-benzofuran-5-yl)methyl]furan-2-carboxamide (PubChem CID 20745800) has the molecular formula C25H28ClN3O5 and a molecular weight of 485.97 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethoxypyrimidin-5-yl)-5-[(1,1,3,3,6-pentamethyl-2-benzofuran-5-yl)methyl]furan-2-carboxamide.
| Compound Name | N-(2-chloro-4,6-dimethoxypyrimidin-5-yl)-5-[(1,1,3,3,6-pentamethyl-2-benzofuran-5-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 20745800 |
| Molecular Formula | C25H28ClN3O5 |
| Molecular Weight | 485.97 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | N-(2-chloro-4,6-dimethoxypyrimidin-5-yl)-5-[(1,1,3,3,6-pentamethyl-2-benzofuran-5-yl)methyl]furan-2-carboxamide |
| SMILES | COc1nc(Cl)nc(OC)c1NC(=O)c1ccc(Cc2cc3c(cc2C)C(C)(C)OC3(C)C)o1 |
| InChI | InChI=1S/C25H28ClN3O5/c1-13-10-16-17(25(4,5)34-24(16,2)3)12-14(13)11-15-8-9-18(33-15)20(30)27-19-21(31-6)28-23(26)29-22(19)32-7/h8-10,12H,11H2,1-7H3,(H,27,30) |
| InChIKey | GLLNXPFOROHXFF-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.97 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |