C28H37N4O6+ — CID 142273880
2-[[4,6-dimethoxy-5-[[5-[(1,1,3,3,6-pentamethyl-2-benzofuran-5-yl)methyl]furan-2-carbonyl]amino]pyrimidin-2-yl]amino]ethyl-methyloxidanium (PubChem CID 142273880) has the molecular formula C28H37N4O6+ and a molecular weight of 525.63 g/mol. Its IUPAC name is 2-[[4,6-dimethoxy-5-[[5-[(1,1,3,3,6-pentamethyl-2-benzofuran-5-yl)methyl]furan-2-carbonyl]amino]pyrimidin-2-yl]amino]ethyl-methyloxidanium.
| Compound Name | 2-[[4,6-dimethoxy-5-[[5-[(1,1,3,3,6-pentamethyl-2-benzofuran-5-yl)methyl]furan-2-carbonyl]amino]pyrimidin-2-yl]amino]ethyl-methyloxidanium |
|---|---|
| PubChem CID | 142273880 |
| Molecular Formula | C28H37N4O6+ |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | 2-[[4,6-dimethoxy-5-[[5-[(1,1,3,3,6-pentamethyl-2-benzofuran-5-yl)methyl]furan-2-carbonyl]amino]pyrimidin-2-yl]amino]ethyl-methyloxidanium |
| SMILES | COc1nc(NCC[OH+]C)nc(OC)c1NC(=O)c1ccc(Cc2cc3c(cc2C)C(C)(C)OC3(C)C)o1 |
| InChI | InChI=1S/C28H36N4O6/c1-16-13-19-20(28(4,5)38-27(19,2)3)15-17(16)14-18-9-10-21(37-18)23(33)30-22-24(35-7)31-26(29-11-12-34-6)32-25(22)36-8/h9-10,13,15H,11-12,14H2,1-8H3,(H,30,33)(H,29,31,32)/p+1 |
| InChIKey | KQDWMOZKKCYHLQ-UHFFFAOYSA-O |
| XLogP | 4.31 |
| TPSA | 120.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|