C32H35BrN4O5 — CID 10153406
N-[2-[(2-bromophenyl)methylamino]-4,6-dimethoxypyrimidin-5-yl]-5-[(1,1,3,3,6-pentamethyl-2-benzofuran-5-yl)methyl]furan-2-carboxamide (PubChem CID 10153406) has the molecular formula C32H35BrN4O5 and a molecular weight of 635.56 g/mol. Its IUPAC name is N-[2-[(2-bromophenyl)methylamino]-4,6-dimethoxypyrimidin-5-yl]-5-[(1,1,3,3,6-pentamethyl-2-benzofuran-5-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[2-[(2-bromophenyl)methylamino]-4,6-dimethoxypyrimidin-5-yl]-5-[(1,1,3,3,6-pentamethyl-2-benzofuran-5-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 10153406 |
| Molecular Formula | C32H35BrN4O5 |
| Molecular Weight | 635.56 g/mol |
| Exact Mass | 634.18 |
| IUPAC Name | N-[2-[(2-bromophenyl)methylamino]-4,6-dimethoxypyrimidin-5-yl]-5-[(1,1,3,3,6-pentamethyl-2-benzofuran-5-yl)methyl]furan-2-carboxamide |
| SMILES | COc1nc(NCc2ccccc2Br)nc(OC)c1NC(=O)c1ccc(Cc2cc3c(cc2C)C(C)(C)OC3(C)C)o1 |
| InChI | InChI=1S/C32H35BrN4O5/c1-18-14-22-23(32(4,5)42-31(22,2)3)16-20(18)15-21-12-13-25(41-21)27(38)35-26-28(39-6)36-30(37-29(26)40-7)34-17-19-10-8-9-11-24(19)33/h8-14,16H,15,17H2,1-7H3,(H,35,38)(H,34,36,37) |
| InChIKey | PXJANBXZXKZVLA-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 107.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.56 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |