C31H33N3O6 — CID 10239668
N-(4,6-dimethoxy-2-phenoxypyrimidin-5-yl)-5-[(1,1,3,3,6-pentamethyl-2-benzofuran-5-yl)methyl]furan-2-carboxamide (PubChem CID 10239668) has the molecular formula C31H33N3O6 and a molecular weight of 543.62 g/mol. Its IUPAC name is N-(4,6-dimethoxy-2-phenoxypyrimidin-5-yl)-5-[(1,1,3,3,6-pentamethyl-2-benzofuran-5-yl)methyl]furan-2-carboxamide.
| Compound Name | N-(4,6-dimethoxy-2-phenoxypyrimidin-5-yl)-5-[(1,1,3,3,6-pentamethyl-2-benzofuran-5-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 10239668 |
| Molecular Formula | C31H33N3O6 |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.24 |
| IUPAC Name | N-(4,6-dimethoxy-2-phenoxypyrimidin-5-yl)-5-[(1,1,3,3,6-pentamethyl-2-benzofuran-5-yl)methyl]furan-2-carboxamide |
| SMILES | COc1nc(Oc2ccccc2)nc(OC)c1NC(=O)c1ccc(Cc2cc3c(cc2C)C(C)(C)OC3(C)C)o1 |
| InChI | InChI=1S/C31H33N3O6/c1-18-15-22-23(31(4,5)40-30(22,2)3)17-19(18)16-21-13-14-24(38-21)26(35)32-25-27(36-6)33-29(34-28(25)37-7)39-20-11-9-8-10-12-20/h8-15,17H,16H2,1-7H3,(H,32,35) |
| InChIKey | WZMAZYRRSBHRIG-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |