C28H45N7O6S — CID 10167770
1-(5-hydroxyoxolan-2-yl)-N-[4-[6-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]hexanoylamino]butyl]imidazole-4-carboxamide (PubChem CID 10167770) has the molecular formula C28H45N7O6S and a molecular weight of 607.78 g/mol. Its IUPAC name is 1-(5-hydroxyoxolan-2-yl)-N-[4-[6-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]hexanoylamino]butyl]imidazole-4-carboxamide.
| Compound Name | 1-(5-hydroxyoxolan-2-yl)-N-[4-[6-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]hexanoylamino]butyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 10167770 |
| Molecular Formula | C28H45N7O6S |
| Molecular Weight | 607.78 g/mol |
| Exact Mass | 607.32 |
| IUPAC Name | 1-(5-hydroxyoxolan-2-yl)-N-[4-[6-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]hexanoylamino]butyl]imidazole-4-carboxamide |
| SMILES | O=C(CCCCCNC(=O)CCCCC1SCC2NC(=O)NC21)NCCCCNC(=O)c1cn(C2CCC(O)O2)cn1 |
| InChI | InChI=1S/C28H45N7O6S/c36-22(30-14-6-7-15-31-27(39)19-16-35(18-32-19)24-11-12-25(38)41-24)9-2-1-5-13-29-23(37)10-4-3-8-21-26-20(17-42-21)33-28(40)34-26/h16,18,20-21,24-26,38H,1-15,17H2,(H,29,37)(H,30,36)(H,31,39)(H2,33,34,40) |
| InChIKey | PNUHOUDQJDSRII-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 175.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.78 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|