C20H14F3N7O — CID 10180738
1-[4-pyridin-3-yl-2-(5H-tetrazol-5-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 10180738) has the molecular formula C20H14F3N7O and a molecular weight of 425.37 g/mol. Its IUPAC name is 1-[4-pyridin-3-yl-2-(5H-tetrazol-5-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-pyridin-3-yl-2-(5H-tetrazol-5-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 10180738 |
| Molecular Formula | C20H14F3N7O |
| Molecular Weight | 425.37 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 1-[4-pyridin-3-yl-2-(5H-tetrazol-5-yl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)Nc1ccc(-c2cccnc2)cc1C1N=NN=N1 |
| InChI | InChI=1S/C20H14F3N7O/c21-20(22,23)14-4-1-5-15(10-14)25-19(31)26-17-7-6-12(13-3-2-8-24-11-13)9-16(17)18-27-29-30-28-18/h1-11,18H,(H2,25,26,31) |
| InChIKey | WERXRLLNBXGMFY-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 103.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.37 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |