C27H31FN6O8S — CID 10189257
bis((E)-but-2-enedioic acid);N-[4-[4-(5-fluoropyrimidin-2-yl)piperazin-1-yl]butyl]-1,3-benzothiazol-2-amine (PubChem CID 10189257) has the molecular formula C27H31FN6O8S and a molecular weight of 618.64 g/mol. Its IUPAC name is bis((E)-but-2-enedioic acid);N-[4-[4-(5-fluoropyrimidin-2-yl)piperazin-1-yl]butyl]-1,3-benzothiazol-2-amine.
| Compound Name | bis((E)-but-2-enedioic acid);N-[4-[4-(5-fluoropyrimidin-2-yl)piperazin-1-yl]butyl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 10189257 |
| Molecular Formula | C27H31FN6O8S |
| Molecular Weight | 618.64 g/mol |
| Exact Mass | 618.19 |
| IUPAC Name | bis((E)-but-2-enedioic acid);N-[4-[4-(5-fluoropyrimidin-2-yl)piperazin-1-yl]butyl]-1,3-benzothiazol-2-amine |
| SMILES | Fc1cnc(N2CCN(CCCCNc3nc4ccccc4s3)CC2)nc1.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H23FN6S.2C4H4O4/c20-15-13-22-18(23-14-15)26-11-9-25(10-12-26)8-4-3-7-21-19-24-16-5-1-2-6-17(16)27-19;2*5-3(6)1-2-4(7)8/h1-2,5-6,13-14H,3-4,7-12H2,(H,21,24);2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+ |
| InChIKey | FQQDVFUGNXAQRT-LVEZLNDCSA-N |
| XLogP | 2.66 |
| TPSA | 206.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.64 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|