C37H42O3 — CID 102019424
[(1R,2S,4R)-4-tert-butyl-2-tritylcyclohexyl] (1R)-6-methyl-2-oxobicyclo[3.1.0]hexane-1-carboxylate (PubChem CID 102019424) has the molecular formula C37H42O3 and a molecular weight of 534.74 g/mol. Its IUPAC name is [(1R,2S,4R)-4-tert-butyl-2-tritylcyclohexyl] (1R)-6-methyl-2-oxobicyclo[3.1.0]hexane-1-carboxylate.
| Compound Name | [(1R,2S,4R)-4-tert-butyl-2-tritylcyclohexyl] (1R)-6-methyl-2-oxobicyclo[3.1.0]hexane-1-carboxylate |
|---|---|
| PubChem CID | 102019424 |
| Molecular Formula | C37H42O3 |
| Molecular Weight | 534.74 g/mol |
| Exact Mass | 534.31 |
| IUPAC Name | [(1R,2S,4R)-4-tert-butyl-2-tritylcyclohexyl] (1R)-6-methyl-2-oxobicyclo[3.1.0]hexane-1-carboxylate |
| SMILES | CC1C2CCC(=O)[C@@]12C(=O)O[C@@H]1CC[C@@H](C(C)(C)C)C[C@H]1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H42O3/c1-25-30-21-23-33(38)36(25,30)34(39)40-32-22-20-29(35(2,3)4)24-31(32)37(26-14-8-5-9-15-26,27-16-10-6-11-17-27)28-18-12-7-13-19-28/h5-19,25,29-32H,20-24H2,1-4H3/t25?,29-,30?,31-,32-,36-/m1/s1 |
| InChIKey | RBGBOYIVRZTOTL-PLOVFFFJSA-N |
| XLogP | 8.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.74 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|