C30H26N4+2 — CID 102025049
3,16-diaza-6,13-diazoniaheptacyclo[16.6.6.28,11.13,6.113,16.019,24.025,30]tetratriaconta-1(25),4,6(34),8(33),9,11(32),13(31),14,18(30),19,21,23,26,28-tetradecaene (PubChem CID 102025049) has the molecular formula C30H26N4+2 and a molecular weight of 442.57 g/mol. Its IUPAC name is 3,16-diaza-6,13-diazoniaheptacyclo[16.6.6.28,11.13,6.113,16.019,24.025,30]tetratriaconta-1(25),4,6(34),8(33),9,11(32),13(31),14,18(30),19,21,23,26,28-tetradecaene.
| Compound Name | 3,16-diaza-6,13-diazoniaheptacyclo[16.6.6.28,11.13,6.113,16.019,24.025,30]tetratriaconta-1(25),4,6(34),8(33),9,11(32),13(31),14,18(30),19,21,23,26,28-tetradecaene |
|---|---|
| PubChem CID | 102025049 |
| Molecular Formula | C30H26N4+2 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 3,16-diaza-6,13-diazoniaheptacyclo[16.6.6.28,11.13,6.113,16.019,24.025,30]tetratriaconta-1(25),4,6(34),8(33),9,11(32),13(31),14,18(30),19,21,23,26,28-tetradecaene |
| SMILES | c1ccc2c3c4ccccc4c(c2c1)Cn1cc[n+](c1)Cc1ccc(cc1)C[n+]1ccn(c1)C3 |
| InChI | InChI=1S/C30H26N4/c1-2-6-26-25(5-1)29-19-33-15-13-31(21-33)17-23-9-11-24(12-10-23)18-32-14-16-34(22-32)20-30(26)28-8-4-3-7-27(28)29/h1-16,21-22H,17-20H2/q+2 |
| InChIKey | CHYWTCVDKZRWIC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|