C20H22N6+2 — CID 101131168
24-methyl-6,13,22,24-tetraza-3,16-diazoniapentacyclo[16.3.1.13,6.18,11.113,16]pentacosa-1(22),3(25),4,8,10,14,16(23),18,20-nonaene (PubChem CID 101131168) has the molecular formula C20H22N6+2 and a molecular weight of 346.44 g/mol. Its IUPAC name is 24-methyl-6,13,22,24-tetraza-3,16-diazoniapentacyclo[16.3.1.13,6.18,11.113,16]pentacosa-1(22),3(25),4,8,10,14,16(23),18,20-nonaene.
| Compound Name | 24-methyl-6,13,22,24-tetraza-3,16-diazoniapentacyclo[16.3.1.13,6.18,11.113,16]pentacosa-1(22),3(25),4,8,10,14,16(23),18,20-nonaene |
|---|---|
| PubChem CID | 101131168 |
| Molecular Formula | C20H22N6+2 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 24-methyl-6,13,22,24-tetraza-3,16-diazoniapentacyclo[16.3.1.13,6.18,11.113,16]pentacosa-1(22),3(25),4,8,10,14,16(23),18,20-nonaene |
| SMILES | Cn1c2ccc1Cn1cc[n+](c1)Cc1cccc(n1)C[n+]1ccn(c1)C2 |
| InChI | InChI=1S/C20H22N6/c1-22-19-5-6-20(22)14-26-10-8-24(16-26)12-18-4-2-3-17(21-18)11-23-7-9-25(13-19)15-23/h2-10,15-16H,11-14H2,1H3/q+2 |
| InChIKey | NRFLNZYUNODHJF-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 35.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|