C33H40O2P2 — CID 102026368
[(1R)-1-[2-[2-[bis(furan-2-yl)phosphanyl]phenyl]cyclopenta-1,3-dien-1-yl]ethyl]-dicyclohexylphosphane (PubChem CID 102026368) has the molecular formula C33H40O2P2 and a molecular weight of 530.63 g/mol. Its IUPAC name is [(1R)-1-[2-[2-[bis(furan-2-yl)phosphanyl]phenyl]cyclopenta-1,3-dien-1-yl]ethyl]-dicyclohexylphosphane.
| Compound Name | [(1R)-1-[2-[2-[bis(furan-2-yl)phosphanyl]phenyl]cyclopenta-1,3-dien-1-yl]ethyl]-dicyclohexylphosphane |
|---|---|
| PubChem CID | 102026368 |
| Molecular Formula | C33H40O2P2 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | [(1R)-1-[2-[2-[bis(furan-2-yl)phosphanyl]phenyl]cyclopenta-1,3-dien-1-yl]ethyl]-dicyclohexylphosphane |
| SMILES | C[C@H](C1=C(c2ccccc2P(c2ccco2)c2ccco2)C=CC1)P(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C33H40O2P2/c1-25(36(26-13-4-2-5-14-26)27-15-6-3-7-16-27)28-18-10-19-29(28)30-17-8-9-20-31(30)37(32-21-11-23-34-32)33-22-12-24-35-33/h8-12,17,19-27H,2-7,13-16,18H2,1H3/t25-/m1/s1 |
| InChIKey | BLLJIEDORLKFQP-RUZDIDTESA-N |
| XLogP | 8.88 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|