C46H34O2+2 — CID 102031841
4-[(E)-1,2-di(cyclopenta-2,4-dien-1-yl)-2-(2,6-diphenylpyrylium-4-yl)ethenyl]-2,6-diphenylpyrylium (PubChem CID 102031841) has the molecular formula C46H34O2+2 and a molecular weight of 618.78 g/mol. Its IUPAC name is 4-[(E)-1,2-di(cyclopenta-2,4-dien-1-yl)-2-(2,6-diphenylpyrylium-4-yl)ethenyl]-2,6-diphenylpyrylium.
| Compound Name | 4-[(E)-1,2-di(cyclopenta-2,4-dien-1-yl)-2-(2,6-diphenylpyrylium-4-yl)ethenyl]-2,6-diphenylpyrylium |
|---|---|
| PubChem CID | 102031841 |
| Molecular Formula | C46H34O2+2 |
| Molecular Weight | 618.78 g/mol |
| Exact Mass | 618.25 |
| IUPAC Name | 4-[(E)-1,2-di(cyclopenta-2,4-dien-1-yl)-2-(2,6-diphenylpyrylium-4-yl)ethenyl]-2,6-diphenylpyrylium |
| SMILES | C1=CC(/C(=C(\c2cc(-c3ccccc3)[o+]c(-c3ccccc3)c2)C2C=CC=C2)c2cc(-c3ccccc3)[o+]c(-c3ccccc3)c2)C=C1 |
| InChI | InChI=1S/C46H34O2/c1-5-17-33(18-6-1)41-29-39(30-42(47-41)34-19-7-2-8-20-34)45(37-25-13-14-26-37)46(38-27-15-16-28-38)40-31-43(35-21-9-3-10-22-35)48-44(32-40)36-23-11-4-12-24-36/h1-32,37-38H/q+2/b46-45+ |
| InChIKey | VEAQTLJGHVFTNP-XVIFHXHVSA-N |
| XLogP | 12.50 |
| TPSA | 22.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.78 |
| LogP ≤ 5 | 12.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|