C20H18ClO+ — CID 134911487
4-(3-chloropropyl)-2,6-diphenylpyrylium (PubChem CID 134911487) has the molecular formula C20H18ClO+ and a molecular weight of 309.82 g/mol. Its IUPAC name is 4-(3-chloropropyl)-2,6-diphenylpyrylium.
| Compound Name | 4-(3-chloropropyl)-2,6-diphenylpyrylium |
|---|---|
| PubChem CID | 134911487 |
| Molecular Formula | C20H18ClO+ |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 4-(3-chloropropyl)-2,6-diphenylpyrylium |
| SMILES | ClCCCc1cc(-c2ccccc2)[o+]c(-c2ccccc2)c1 |
| InChI | InChI=1S/C20H18ClO/c21-13-7-8-16-14-19(17-9-3-1-4-10-17)22-20(15-16)18-11-5-2-6-12-18/h1-6,9-12,14-15H,7-8,13H2/q+1 |
| InChIKey | GIAVPUBCLFWQFZ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|