C13H14N2O2S — CID 102037654
3,6-dimethyl-4-(4-methylphenyl)sulfonylpyridazine (PubChem CID 102037654) has the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. Its IUPAC name is 3,6-dimethyl-4-(4-methylphenyl)sulfonylpyridazine.
| Compound Name | 3,6-dimethyl-4-(4-methylphenyl)sulfonylpyridazine |
|---|---|
| PubChem CID | 102037654 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 3,6-dimethyl-4-(4-methylphenyl)sulfonylpyridazine |
| SMILES | Cc1ccc(S(=O)(=O)c2cc(C)nnc2C)cc1 |
| InChI | InChI=1S/C13H14N2O2S/c1-9-4-6-12(7-5-9)18(16,17)13-8-10(2)14-15-11(13)3/h4-8H,1-3H3 |
| InChIKey | ZNAHWNGTNHZDOK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |