C45H36F6N2O2S2 — CID 102042230
9-ethyl-3-[4-[2-[5-(9-ethyl-6-methoxycarbazol-3-yl)-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]-6-methoxycarbazole (PubChem CID 102042230) has the molecular formula C45H36F6N2O2S2 and a molecular weight of 814.92 g/mol. Its IUPAC name is 9-ethyl-3-[4-[2-[5-(9-ethyl-6-methoxycarbazol-3-yl)-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]-6-methoxycarbazole.
| Compound Name | 9-ethyl-3-[4-[2-[5-(9-ethyl-6-methoxycarbazol-3-yl)-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]-6-methoxycarbazole |
|---|---|
| PubChem CID | 102042230 |
| Molecular Formula | C45H36F6N2O2S2 |
| Molecular Weight | 814.92 g/mol |
| Exact Mass | 814.21 |
| IUPAC Name | 9-ethyl-3-[4-[2-[5-(9-ethyl-6-methoxycarbazol-3-yl)-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]-6-methoxycarbazole |
| SMILES | CCn1c2ccc(OC)cc2c2cc(-c3cc(C4=C(c5cc(-c6ccc7c(c6)c6cc(OC)ccc6n7CC)sc5C)C(F)(F)C(F)(F)C4(F)F)c(C)s3)ccc21 |
| InChI | InChI=1S/C45H36F6N2O2S2/c1-7-52-35-13-9-25(17-31(35)33-19-27(54-5)11-15-37(33)52)39-21-29(23(3)56-39)41-42(44(48,49)45(50,51)43(41,46)47)30-22-40(57-24(30)4)26-10-14-36-32(18-26)34-20-28(55-6)12-16-38(34)53(36)8-2/h9-22H,7-8H2,1-6H3 |
| InChIKey | ORRYROSEEOIPBZ-UHFFFAOYSA-N |
| XLogP | 13.86 |
| TPSA | 28.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.92 |
| LogP ≤ 5 | 13.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|