C17H25NO4Si2 — CID 102042582
2-[1,1-bis(trimethylsilyloxy)prop-1-en-2-yl]isoindole-1,3-dione (PubChem CID 102042582) has the molecular formula C17H25NO4Si2 and a molecular weight of 363.56 g/mol. Its IUPAC name is 2-[1,1-bis(trimethylsilyloxy)prop-1-en-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[1,1-bis(trimethylsilyloxy)prop-1-en-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 102042582 |
| Molecular Formula | C17H25NO4Si2 |
| Molecular Weight | 363.56 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 2-[1,1-bis(trimethylsilyloxy)prop-1-en-2-yl]isoindole-1,3-dione |
| SMILES | CC(=C(O[Si](C)(C)C)O[Si](C)(C)C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H25NO4Si2/c1-12(17(21-23(2,3)4)22-24(5,6)7)18-15(19)13-10-8-9-11-14(13)16(18)20/h8-11H,1-7H3 |
| InChIKey | IPURTWRIZJGUMB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.56 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|