C25H40N2O4Si2 — CID 10601088
2-[(Z)-2-trimethylsilyloxy-2-[(E)-[(2S)-2-tri(propan-2-yl)silyloxypropylidene]amino]ethenyl]isoindole-1,3-dione (PubChem CID 10601088) has the molecular formula C25H40N2O4Si2 and a molecular weight of 488.78 g/mol. Its IUPAC name is 2-[(Z)-2-trimethylsilyloxy-2-[(E)-[(2S)-2-tri(propan-2-yl)silyloxypropylidene]amino]ethenyl]isoindole-1,3-dione.
| Compound Name | 2-[(Z)-2-trimethylsilyloxy-2-[(E)-[(2S)-2-tri(propan-2-yl)silyloxypropylidene]amino]ethenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10601088 |
| Molecular Formula | C25H40N2O4Si2 |
| Molecular Weight | 488.78 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | 2-[(Z)-2-trimethylsilyloxy-2-[(E)-[(2S)-2-tri(propan-2-yl)silyloxypropylidene]amino]ethenyl]isoindole-1,3-dione |
| SMILES | CC(C)[Si](O[C@@H](C)/C=N/C(=C/N1C(=O)c2ccccc2C1=O)O[Si](C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H40N2O4Si2/c1-17(2)33(18(3)4,19(5)6)30-20(7)15-26-23(31-32(8,9)10)16-27-24(28)21-13-11-12-14-22(21)25(27)29/h11-20H,1-10H3/b23-16-,26-15+/t20-/m0/s1 |
| InChIKey | DSFZLXSPCGAHDJ-RLGQPCGUSA-N |
| XLogP | 6.58 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.78 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|