C20H22N2O3 — CID 102072896
benzyl 2-(3-oxopropyl)-5,6,7,8-tetrahydropyrido[2,3-b]azepine-9-carboxylate (PubChem CID 102072896) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is benzyl 2-(3-oxopropyl)-5,6,7,8-tetrahydropyrido[2,3-b]azepine-9-carboxylate.
| Compound Name | benzyl 2-(3-oxopropyl)-5,6,7,8-tetrahydropyrido[2,3-b]azepine-9-carboxylate |
|---|---|
| PubChem CID | 102072896 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | benzyl 2-(3-oxopropyl)-5,6,7,8-tetrahydropyrido[2,3-b]azepine-9-carboxylate |
| SMILES | O=CCCc1ccc2c(n1)N(C(=O)OCc1ccccc1)CCCC2 |
| InChI | InChI=1S/C20H22N2O3/c23-14-6-10-18-12-11-17-9-4-5-13-22(19(17)21-18)20(24)25-15-16-7-2-1-3-8-16/h1-3,7-8,11-12,14H,4-6,9-10,13,15H2 |
| InChIKey | FSHWSLVPGRNBMF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|