C38H46N6O8 — CID 102080725
ethyl (2S)-2-[[(E)-5-[[(2S)-2-amino-5-[bis(phenylmethoxycarbonylamino)methylideneamino]pentanoyl]amino]pent-2-enoyl]amino]-3-phenylpropanoate (PubChem CID 102080725) has the molecular formula C38H46N6O8 and a molecular weight of 714.82 g/mol. Its IUPAC name is ethyl (2S)-2-[[(E)-5-[[(2S)-2-amino-5-[bis(phenylmethoxycarbonylamino)methylideneamino]pentanoyl]amino]pent-2-enoyl]amino]-3-phenylpropanoate.
| Compound Name | ethyl (2S)-2-[[(E)-5-[[(2S)-2-amino-5-[bis(phenylmethoxycarbonylamino)methylideneamino]pentanoyl]amino]pent-2-enoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 102080725 |
| Molecular Formula | C38H46N6O8 |
| Molecular Weight | 714.82 g/mol |
| Exact Mass | 714.34 |
| IUPAC Name | ethyl (2S)-2-[[(E)-5-[[(2S)-2-amino-5-[bis(phenylmethoxycarbonylamino)methylideneamino]pentanoyl]amino]pent-2-enoyl]amino]-3-phenylpropanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccccc1)NC(=O)/C=C/CCNC(=O)[C@@H](N)CCCN=C(NC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C38H46N6O8/c1-2-50-35(47)32(25-28-15-6-3-7-16-28)42-33(45)22-12-13-23-40-34(46)31(39)21-14-24-41-36(43-37(48)51-26-29-17-8-4-9-18-29)44-38(49)52-27-30-19-10-5-11-20-30/h3-12,15-20,22,31-32H,2,13-14,21,23-27,39H2,1H3,(H,40,46)(H,42,45)(H2,41,43,44,48,49)/b22-12+/t31-,32-/m0/s1 |
| InChIKey | MOFRSFWGATYDHD-OCMKAKHUSA-N |
| XLogP | 3.66 |
| TPSA | 199.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.82 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|