C18H21NO4S — CID 102085019
[(1R)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]prop-2-ynyl] acetate (PubChem CID 102085019) has the molecular formula C18H21NO4S and a molecular weight of 347.44 g/mol. Its IUPAC name is [(1R)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]prop-2-ynyl] acetate.
| Compound Name | [(1R)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]prop-2-ynyl] acetate |
|---|---|
| PubChem CID | 102085019 |
| Molecular Formula | C18H21NO4S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | [(1R)-1-[(1R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-1-yl]prop-2-ynyl] acetate |
| SMILES | C#C[C@@H](OC(C)=O)[C@@]12CCCC[C@@H]1N2S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H21NO4S/c1-4-17(23-14(3)20)18-12-6-5-7-16(18)19(18)24(21,22)15-10-8-13(2)9-11-15/h1,8-11,16-17H,5-7,12H2,2-3H3/t16-,17+,18+,19?/m0/s1 |
| InChIKey | QPQKTWRNDXHLPP-JCIRIWACSA-N |
| XLogP | 2.25 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|