C33H56O11 — CID 102091840
[(2R,3R,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[(Z,3R,4R)-4-hydroxy-3-methylhex-1-enoxy]oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 102091840) has the molecular formula C33H56O11 and a molecular weight of 628.80 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[(Z,3R,4R)-4-hydroxy-3-methylhex-1-enoxy]oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[(Z,3R,4R)-4-hydroxy-3-methylhex-1-enoxy]oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102091840 |
| Molecular Formula | C33H56O11 |
| Molecular Weight | 628.80 g/mol |
| Exact Mass | 628.38 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[(Z,3R,4R)-4-hydroxy-3-methylhex-1-enoxy]oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC[C@@H](O)[C@H](C)/C=C\O[C@@H]1O[C@H](COC(=O)C(C)(C)C)[C@@H](OC(=O)C(C)(C)C)[C@H](OC(=O)C(C)(C)C)[C@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C33H56O11/c1-15-20(34)19(2)16-17-39-25-24(44-29(38)33(12,13)14)23(43-28(37)32(9,10)11)22(42-27(36)31(6,7)8)21(41-25)18-40-26(35)30(3,4)5/h16-17,19-25,34H,15,18H2,1-14H3/b17-16-/t19-,20-,21-,22-,23+,24-,25-/m1/s1 |
| InChIKey | PBEIYUINXKTTCI-FMINIDBOSA-N |
| XLogP | 5.11 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.80 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|