C10H19N5O2S2 — CID 102104536
N-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]dithiolane-4-carboxamide (PubChem CID 102104536) has the molecular formula C10H19N5O2S2 and a molecular weight of 305.43 g/mol. Its IUPAC name is N-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]dithiolane-4-carboxamide.
| Compound Name | N-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]dithiolane-4-carboxamide |
|---|---|
| PubChem CID | 102104536 |
| Molecular Formula | C10H19N5O2S2 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | N-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]dithiolane-4-carboxamide |
| SMILES | NC(=O)[C@H](CCCN=C(N)N)NC(=O)C1CSSC1 |
| InChI | InChI=1S/C10H19N5O2S2/c11-8(16)7(2-1-3-14-10(12)13)15-9(17)6-4-18-19-5-6/h6-7H,1-5H2,(H2,11,16)(H,15,17)(H4,12,13,14)/t7-/m0/s1 |
| InChIKey | CVUICXCQTOEMCL-ZETCQYMHSA-N |
| XLogP | -0.98 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|