C11H21N5O3 — CID 167003457
(2R)-5-(diaminomethylideneamino)-2-[(2,2-dimethyl-3-oxopropanoyl)amino]pentanamide (PubChem CID 167003457) has the molecular formula C11H21N5O3 and a molecular weight of 271.32 g/mol. Its IUPAC name is (2R)-5-(diaminomethylideneamino)-2-[(2,2-dimethyl-3-oxopropanoyl)amino]pentanamide.
| Compound Name | (2R)-5-(diaminomethylideneamino)-2-[(2,2-dimethyl-3-oxopropanoyl)amino]pentanamide |
|---|---|
| PubChem CID | 167003457 |
| Molecular Formula | C11H21N5O3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (2R)-5-(diaminomethylideneamino)-2-[(2,2-dimethyl-3-oxopropanoyl)amino]pentanamide |
| SMILES | CC(C)(C=O)C(=O)N[C@H](CCCN=C(N)N)C(N)=O |
| InChI | InChI=1S/C11H21N5O3/c1-11(2,6-17)9(19)16-7(8(12)18)4-3-5-15-10(13)14/h6-7H,3-5H2,1-2H3,(H2,12,18)(H,16,19)(H4,13,14,15)/t7-/m1/s1 |
| InChIKey | PKQBOEPJGUQMJI-SSDOTTSWSA-N |
| XLogP | -1.76 |
| TPSA | 153.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|