C11H9F4NaO4S — CID 102108015
sodium 3-(4-ethenyl-2,3,5,6-tetrafluorophenoxy)propane-1-sulfonate (PubChem CID 102108015) has the molecular formula C11H9F4NaO4S and a molecular weight of 336.24 g/mol. Its IUPAC name is sodium 3-(4-ethenyl-2,3,5,6-tetrafluorophenoxy)propane-1-sulfonate.
| Compound Name | sodium 3-(4-ethenyl-2,3,5,6-tetrafluorophenoxy)propane-1-sulfonate |
|---|---|
| PubChem CID | 102108015 |
| Molecular Formula | C11H9F4NaO4S |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | sodium 3-(4-ethenyl-2,3,5,6-tetrafluorophenoxy)propane-1-sulfonate |
| SMILES | C=Cc1c(F)c(F)c(OCCCS(=O)(=O)[O-])c(F)c1F.[Na+] |
| InChI | InChI=1S/C11H10F4O4S.Na/c1-2-6-7(12)9(14)11(10(15)8(6)13)19-4-3-5-20(16,17)18;/h2H,1,3-5H2,(H,16,17,18);/q;+1/p-1 |
| InChIKey | HVIBBYPTLBSQLY-UHFFFAOYSA-M |
| XLogP | -0.80 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|