C11H10F4O3S — CID 138710745
3-(4-ethenyl-2,3,5,6-tetrafluorophenoxy)propane-1-sulfinic acid (PubChem CID 138710745) has the molecular formula C11H10F4O3S and a molecular weight of 298.26 g/mol. Its IUPAC name is 3-(4-ethenyl-2,3,5,6-tetrafluorophenoxy)propane-1-sulfinic acid.
| Compound Name | 3-(4-ethenyl-2,3,5,6-tetrafluorophenoxy)propane-1-sulfinic acid |
|---|---|
| PubChem CID | 138710745 |
| Molecular Formula | C11H10F4O3S |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 3-(4-ethenyl-2,3,5,6-tetrafluorophenoxy)propane-1-sulfinic acid |
| SMILES | C=Cc1c(F)c(F)c(OCCCS(=O)O)c(F)c1F |
| InChI | InChI=1S/C11H10F4O3S/c1-2-6-7(12)9(14)11(10(15)8(6)13)18-4-3-5-19(16)17/h2H,1,3-5H2,(H,16,17) |
| InChIKey | HKBFBDCZKBSQHU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|