C12H3BrF4OS — CID 102111147
8-bromo-1,2,3,4-tetrafluorophenoxathiine (PubChem CID 102111147) has the molecular formula C12H3BrF4OS and a molecular weight of 351.12 g/mol. Its IUPAC name is 8-bromo-1,2,3,4-tetrafluorophenoxathiine.
| Compound Name | 8-bromo-1,2,3,4-tetrafluorophenoxathiine |
|---|---|
| PubChem CID | 102111147 |
| Molecular Formula | C12H3BrF4OS |
| Molecular Weight | 351.12 g/mol |
| Exact Mass | 349.90 |
| IUPAC Name | 8-bromo-1,2,3,4-tetrafluorophenoxathiine |
| SMILES | Fc1c(F)c(F)c2c(c1F)Oc1ccc(Br)cc1S2 |
| InChI | InChI=1S/C12H3BrF4OS/c13-4-1-2-5-6(3-4)19-12-10(17)8(15)7(14)9(16)11(12)18-5/h1-3H |
| InChIKey | HJMALFONFHJJSK-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.12 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|