C19H19N5O — CID 102129719
(3S)-3-(2-azidoethyl)-3-(5-methyl-2,3-dihydroindol-1-yl)-1H-indol-2-one (PubChem CID 102129719) has the molecular formula C19H19N5O and a molecular weight of 333.40 g/mol. Its IUPAC name is (3S)-3-(2-azidoethyl)-3-(5-methyl-2,3-dihydroindol-1-yl)-1H-indol-2-one.
| Compound Name | (3S)-3-(2-azidoethyl)-3-(5-methyl-2,3-dihydroindol-1-yl)-1H-indol-2-one |
|---|---|
| PubChem CID | 102129719 |
| Molecular Formula | C19H19N5O |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (3S)-3-(2-azidoethyl)-3-(5-methyl-2,3-dihydroindol-1-yl)-1H-indol-2-one |
| SMILES | Cc1ccc2c(c1)CCN2[C@]1(CCN=[N+]=[N-])C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C19H19N5O/c1-13-6-7-17-14(12-13)8-11-24(17)19(9-10-21-23-20)15-4-2-3-5-16(15)22-18(19)25/h2-7,12H,8-11H2,1H3,(H,22,25)/t19-/m0/s1 |
| InChIKey | WEAFIRFBVGSPSF-IBGZPJMESA-N |
| XLogP | 3.91 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|