C17H12Br2O2S2 — CID 102137065
2-bromo-1-[5-(2-bromoacetyl)-3-methyl-4-phenylthieno[2,3-b]thiophen-2-yl]ethanone (PubChem CID 102137065) has the molecular formula C17H12Br2O2S2 and a molecular weight of 472.22 g/mol. Its IUPAC name is 2-bromo-1-[5-(2-bromoacetyl)-3-methyl-4-phenylthieno[2,3-b]thiophen-2-yl]ethanone.
| Compound Name | 2-bromo-1-[5-(2-bromoacetyl)-3-methyl-4-phenylthieno[2,3-b]thiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 102137065 |
| Molecular Formula | C17H12Br2O2S2 |
| Molecular Weight | 472.22 g/mol |
| Exact Mass | 469.86 |
| IUPAC Name | 2-bromo-1-[5-(2-bromoacetyl)-3-methyl-4-phenylthieno[2,3-b]thiophen-2-yl]ethanone |
| SMILES | Cc1c(C(=O)CBr)sc2sc(C(=O)CBr)c(-c3ccccc3)c12 |
| InChI | InChI=1S/C17H12Br2O2S2/c1-9-13-14(10-5-3-2-4-6-10)16(12(21)8-19)23-17(13)22-15(9)11(20)7-18/h2-6H,7-8H2,1H3 |
| InChIKey | NSEPSUFSLUXGAP-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.22 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|