C15H10F6 — CID 102138336
1,2-di(cyclopenta-2,4-dien-1-yl)-3,3,4,4,5,5-hexafluorocyclopentene (PubChem CID 102138336) has the molecular formula C15H10F6 and a molecular weight of 304.23 g/mol. Its IUPAC name is 1,2-di(cyclopenta-2,4-dien-1-yl)-3,3,4,4,5,5-hexafluorocyclopentene.
| Compound Name | 1,2-di(cyclopenta-2,4-dien-1-yl)-3,3,4,4,5,5-hexafluorocyclopentene |
|---|---|
| PubChem CID | 102138336 |
| Molecular Formula | C15H10F6 |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 1,2-di(cyclopenta-2,4-dien-1-yl)-3,3,4,4,5,5-hexafluorocyclopentene |
| SMILES | FC1(F)C(C2C=CC=C2)=C(C2C=CC=C2)C(F)(F)C1(F)F |
| InChI | InChI=1S/C15H10F6/c16-13(17)11(9-5-1-2-6-9)12(10-7-3-4-8-10)14(18,19)15(13,20)21/h1-10H |
| InChIKey | AZMADWIZEKYMTP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|