About dipotassium;(Z)-5-oxido-3-oxooct-4-enoate
dipotassium;(Z)-5-oxido-3-oxooct-4-enoate (PubChem CID 102152925) has the molecular formula C8H10K2O4
and a molecular weight of 248.36 g/mol. Its IUPAC name is dipotassium;(Z)-5-oxido-3-oxooct-4-enoate.
Molecular Properties
| Compound Name | dipotassium;(Z)-5-oxido-3-oxooct-4-enoate |
| PubChem CID | 102152925 |
| Molecular Formula | C8H10K2O4 |
| Molecular Weight | 248.36 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | dipotassium;(Z)-5-oxido-3-oxooct-4-enoate |
| SMILES | CCC/C([O-])=C/C(=O)CC(=O)[O-].[K+].[K+] |
| InChI | InChI=1S/C8H12O4.2K/c1-2-3-6(9)4-7(10)5-8(11)12;;/h4,9H,2-3,5H2,1H3,(H,11,12);;/q;2*+1/p-2/b6-4-;; |
| InChIKey | BWERFHCMHSWPJZ-XFUGJFOESA-L |
| XLogP | -7.25 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.36 |
| LogP ≤ 5 | -7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;(Z)-5-oxido-3-oxooct-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;(Z)-5-oxido-3-oxooct-4-enoate?
The IUPAC name of dipotassium;(Z)-5-oxido-3-oxooct-4-enoate (CID 102152925) is dipotassium;(Z)-5-oxido-3-oxooct-4-enoate.
What is the SMILES notation for dipotassium;(Z)-5-oxido-3-oxooct-4-enoate?
The canonical SMILES for dipotassium;(Z)-5-oxido-3-oxooct-4-enoate is CCC/C([O-])=C/C(=O)CC(=O)[O-].[K+].[K+].
What is the InChIKey of dipotassium;(Z)-5-oxido-3-oxooct-4-enoate?
The InChIKey is BWERFHCMHSWPJZ-XFUGJFOESA-L. The full InChI is InChI=1S/C8H12O4.2K/c1-2-3-6(9)4-7(10)5-8(11)12;;/h4,9H,2-3,5H2,1H3,(H,11,12);;/q;2*+1/p-2/b6-4-;;.
What are the key properties of dipotassium;(Z)-5-oxido-3-oxooct-4-enoate?
dipotassium;(Z)-5-oxido-3-oxooct-4-enoate has a molecular weight of 248.36 g/mol, XLogP of -7.25, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;(Z)-5-oxido-3-oxooct-4-enoate is sourced from PubChem (CID 102152925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).