C23H26N8 — CID 10216381
4-(2-ethylpyrazolo[1,5-b]pyridazin-3-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine (PubChem CID 10216381) has the molecular formula C23H26N8 and a molecular weight of 414.52 g/mol. Its IUPAC name is 4-(2-ethylpyrazolo[1,5-b]pyridazin-3-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine.
| Compound Name | 4-(2-ethylpyrazolo[1,5-b]pyridazin-3-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 10216381 |
| Molecular Formula | C23H26N8 |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 4-(2-ethylpyrazolo[1,5-b]pyridazin-3-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine |
| SMILES | CCc1nn2ncccc2c1-c1ccnc(Nc2ccc(N3CCN(C)CC3)cc2)n1 |
| InChI | InChI=1S/C23H26N8/c1-3-19-22(21-5-4-11-25-31(21)28-19)20-10-12-24-23(27-20)26-17-6-8-18(9-7-17)30-15-13-29(2)14-16-30/h4-12H,3,13-16H2,1-2H3,(H,24,26,27) |
| InChIKey | RBIONWHBBUZDRJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|