C23H28N8 — CID 142885734
4-[3,5-dimethyl-1-[(Z)-prop-2-enylideneamino]pyrazol-4-yl]-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine (PubChem CID 142885734) has the molecular formula C23H28N8 and a molecular weight of 416.53 g/mol. Its IUPAC name is 4-[3,5-dimethyl-1-[(Z)-prop-2-enylideneamino]pyrazol-4-yl]-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine.
| Compound Name | 4-[3,5-dimethyl-1-[(Z)-prop-2-enylideneamino]pyrazol-4-yl]-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 142885734 |
| Molecular Formula | C23H28N8 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 4-[3,5-dimethyl-1-[(Z)-prop-2-enylideneamino]pyrazol-4-yl]-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine |
| SMILES | C=C/C=N\n1nc(C)c(-c2ccnc(Nc3ccc(N4CCN(C)CC4)cc3)n2)c1C |
| InChI | InChI=1S/C23H28N8/c1-5-11-25-31-18(3)22(17(2)28-31)21-10-12-24-23(27-21)26-19-6-8-20(9-7-19)30-15-13-29(4)14-16-30/h5-12H,1,13-16H2,2-4H3,(H,24,26,27)/b25-11- |
| InChIKey | QFWLBAHJBUOLFN-GATIEOLUSA-N |
| XLogP | 3.47 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|