C26H36N8 — CID 142885736
4-[3-butyl-5-methyl-1-[(Z)-propylideneamino]pyrazol-4-yl]-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine (PubChem CID 142885736) has the molecular formula C26H36N8 and a molecular weight of 460.63 g/mol. Its IUPAC name is 4-[3-butyl-5-methyl-1-[(Z)-propylideneamino]pyrazol-4-yl]-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine.
| Compound Name | 4-[3-butyl-5-methyl-1-[(Z)-propylideneamino]pyrazol-4-yl]-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 142885736 |
| Molecular Formula | C26H36N8 |
| Molecular Weight | 460.63 g/mol |
| Exact Mass | 460.31 |
| IUPAC Name | 4-[3-butyl-5-methyl-1-[(Z)-propylideneamino]pyrazol-4-yl]-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine |
| SMILES | CC/C=N\n1nc(CCCC)c(-c2ccnc(Nc3ccc(N4CCN(C)CC4)cc3)n2)c1C |
| InChI | InChI=1S/C26H36N8/c1-5-7-8-24-25(20(3)34(31-24)28-14-6-2)23-13-15-27-26(30-23)29-21-9-11-22(12-10-21)33-18-16-32(4)17-19-33/h9-15H,5-8,16-19H2,1-4H3,(H,27,29,30)/b28-14- |
| InChIKey | PMLQJLMGVGDMNL-MUXKCCDJSA-N |
| XLogP | 4.73 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.63 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|