C32H26N2 — CID 102184807
(1S,14R)-14,21-diphenyl-3,13-diazapentacyclo[11.9.0.02,10.04,9.015,20]docosa-2(10),4,6,8,15,17,19,21-octaene (PubChem CID 102184807) has the molecular formula C32H26N2 and a molecular weight of 438.57 g/mol. Its IUPAC name is (1S,14R)-14,21-diphenyl-3,13-diazapentacyclo[11.9.0.02,10.04,9.015,20]docosa-2(10),4,6,8,15,17,19,21-octaene.
| Compound Name | (1S,14R)-14,21-diphenyl-3,13-diazapentacyclo[11.9.0.02,10.04,9.015,20]docosa-2(10),4,6,8,15,17,19,21-octaene |
|---|---|
| PubChem CID | 102184807 |
| Molecular Formula | C32H26N2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | (1S,14R)-14,21-diphenyl-3,13-diazapentacyclo[11.9.0.02,10.04,9.015,20]docosa-2(10),4,6,8,15,17,19,21-octaene |
| SMILES | C1=C(c2ccccc2)c2ccccc2[C@@H](c2ccccc2)N2CCc3c([nH]c4ccccc34)[C@H]12 |
| InChI | InChI=1S/C32H26N2/c1-3-11-22(12-4-1)28-21-30-31-26(25-16-9-10-18-29(25)33-31)19-20-34(30)32(23-13-5-2-6-14-23)27-17-8-7-15-24(27)28/h1-18,21,30,32-33H,19-20H2/t30-,32+/m0/s1 |
| InChIKey | KEVDMYMLZFJHTI-XDFJSJKPSA-N |
| XLogP | 7.30 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|