C20H24N2O7S — CID 102200978
N-(3-methylbut-2-enyl)-2-nitro-N-(3,4,5-trimethoxyphenyl)benzenesulfonamide (PubChem CID 102200978) has the molecular formula C20H24N2O7S and a molecular weight of 436.49 g/mol. Its IUPAC name is N-(3-methylbut-2-enyl)-2-nitro-N-(3,4,5-trimethoxyphenyl)benzenesulfonamide.
| Compound Name | N-(3-methylbut-2-enyl)-2-nitro-N-(3,4,5-trimethoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 102200978 |
| Molecular Formula | C20H24N2O7S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | N-(3-methylbut-2-enyl)-2-nitro-N-(3,4,5-trimethoxyphenyl)benzenesulfonamide |
| SMILES | COc1cc(N(CC=C(C)C)S(=O)(=O)c2ccccc2[N+](=O)[O-])cc(OC)c1OC |
| InChI | InChI=1S/C20H24N2O7S/c1-14(2)10-11-21(15-12-17(27-3)20(29-5)18(13-15)28-4)30(25,26)19-9-7-6-8-16(19)22(23)24/h6-10,12-13H,11H2,1-5H3 |
| InChIKey | FSQDXNMKXPIBBO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|