C20H22O — CID 102201527
(7R)-7,11-dimethyl-1-phenyldodec-10-en-1,4-diyn-3-one (PubChem CID 102201527) has the molecular formula C20H22O and a molecular weight of 278.39 g/mol. Its IUPAC name is (7R)-7,11-dimethyl-1-phenyldodec-10-en-1,4-diyn-3-one.
| Compound Name | (7R)-7,11-dimethyl-1-phenyldodec-10-en-1,4-diyn-3-one |
|---|---|
| PubChem CID | 102201527 |
| Molecular Formula | C20H22O |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | (7R)-7,11-dimethyl-1-phenyldodec-10-en-1,4-diyn-3-one |
| SMILES | CC(C)=CCC[C@@H](C)CC#CC(=O)C#Cc1ccccc1 |
| InChI | InChI=1S/C20H22O/c1-17(2)9-7-10-18(3)11-8-14-20(21)16-15-19-12-5-4-6-13-19/h4-6,9,12-13,18H,7,10-11H2,1-3H3/t18-/m1/s1 |
| InChIKey | BKYNKUAQMSCXJR-GOSISDBHSA-N |
| XLogP | 4.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_yne_A(1)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|