C11H12OSe — CID 102204602
2-phenyl-3,4-dihydro-2H-selenopyran-4-ol (PubChem CID 102204602) has the molecular formula C11H12OSe and a molecular weight of 239.18 g/mol. Its IUPAC name is 2-phenyl-3,4-dihydro-2H-selenopyran-4-ol.
| Compound Name | 2-phenyl-3,4-dihydro-2H-selenopyran-4-ol |
|---|---|
| PubChem CID | 102204602 |
| Molecular Formula | C11H12OSe |
| Molecular Weight | 239.18 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | 2-phenyl-3,4-dihydro-2H-selenopyran-4-ol |
| SMILES | OC1C=C[Se]C(c2ccccc2)C1 |
| InChI | InChI=1S/C11H12OSe/c12-10-6-7-13-11(8-10)9-4-2-1-3-5-9/h1-7,10-12H,8H2 |
| InChIKey | MHNIVOBQZIQBMP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.18 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|