C20H40O2 — CID 102207655
(E)-3,7,11,15-tetramethylhexadec-2-ene-1,4-diol (PubChem CID 102207655) has the molecular formula C20H40O2 and a molecular weight of 312.54 g/mol. Its IUPAC name is (E)-3,7,11,15-tetramethylhexadec-2-ene-1,4-diol.
| Compound Name | (E)-3,7,11,15-tetramethylhexadec-2-ene-1,4-diol |
|---|---|
| PubChem CID | 102207655 |
| Molecular Formula | C20H40O2 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.30 |
| IUPAC Name | (E)-3,7,11,15-tetramethylhexadec-2-ene-1,4-diol |
| SMILES | C/C(=C\CO)C(O)CCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C20H40O2/c1-16(2)8-6-9-17(3)10-7-11-18(4)12-13-20(22)19(5)14-15-21/h14,16-18,20-22H,6-13,15H2,1-5H3/b19-14+ |
| InChIKey | DKQRLSNFOUOBHW-XMHGGMMESA-N |
| XLogP | 5.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|