C31H34N4O4S — CID 102227339
N-[2-[(4R,5'aS,10'bR)-5-ethoxy-5'-(4-methylphenyl)sulfonylspiro[2,3-dihydropyrrole-4,11'-5a,6-dihydroindolo[2,3-b]quinoline]-10'b-yl]ethyl]-N-methylformamide (PubChem CID 102227339) has the molecular formula C31H34N4O4S and a molecular weight of 558.70 g/mol. Its IUPAC name is N-[2-[(4R,5'aS,10'bR)-5-ethoxy-5'-(4-methylphenyl)sulfonylspiro[2,3-dihydropyrrole-4,11'-5a,6-dihydroindolo[2,3-b]quinoline]-10'b-yl]ethyl]-N-methylformamide.
| Compound Name | N-[2-[(4R,5'aS,10'bR)-5-ethoxy-5'-(4-methylphenyl)sulfonylspiro[2,3-dihydropyrrole-4,11'-5a,6-dihydroindolo[2,3-b]quinoline]-10'b-yl]ethyl]-N-methylformamide |
|---|---|
| PubChem CID | 102227339 |
| Molecular Formula | C31H34N4O4S |
| Molecular Weight | 558.70 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | N-[2-[(4R,5'aS,10'bR)-5-ethoxy-5'-(4-methylphenyl)sulfonylspiro[2,3-dihydropyrrole-4,11'-5a,6-dihydroindolo[2,3-b]quinoline]-10'b-yl]ethyl]-N-methylformamide |
| SMILES | CCOC1=NCC[C@]12c1ccccc1N(S(=O)(=O)c1ccc(C)cc1)[C@@H]1Nc3ccccc3[C@@]12CCN(C)C=O |
| InChI | InChI=1S/C31H34N4O4S/c1-4-39-29-31(17-19-32-29)25-10-6-8-12-27(25)35(40(37,38)23-15-13-22(2)14-16-23)28-30(31,18-20-34(3)21-36)24-9-5-7-11-26(24)33-28/h5-16,21,28,33H,4,17-20H2,1-3H3/t28-,30-,31-/m0/s1 |
| InChIKey | AWWAOOPNCNGJQX-ASVWTAOFSA-N |
| XLogP | 4.45 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.70 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|